C21H29F2NO7 — CID 10837050
[1,1-difluoro-2-(2-methoxyethoxymethoxy)-4,4-dimethylpent-1-en-3-yl] 2-(phenylmethoxycarbonylamino)acetate (PubChem CID 10837050) has the molecular formula C21H29F2NO7 and a molecular weight of 445.46 g/mol. Its IUPAC name is [1,1-difluoro-2-(2-methoxyethoxymethoxy)-4,4-dimethylpent-1-en-3-yl] 2-(phenylmethoxycarbonylamino)acetate.
| Compound Name | [1,1-difluoro-2-(2-methoxyethoxymethoxy)-4,4-dimethylpent-1-en-3-yl] 2-(phenylmethoxycarbonylamino)acetate |
|---|---|
| PubChem CID | 10837050 |
| Molecular Formula | C21H29F2NO7 |
| Molecular Weight | 445.46 g/mol |
| Exact Mass | 445.19 |
| IUPAC Name | [1,1-difluoro-2-(2-methoxyethoxymethoxy)-4,4-dimethylpent-1-en-3-yl] 2-(phenylmethoxycarbonylamino)acetate |
| SMILES | COCCOCOC(=C(F)F)C(OC(=O)CNC(=O)OCc1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C21H29F2NO7/c1-21(2,3)18(17(19(22)23)30-14-28-11-10-27-4)31-16(25)12-24-20(26)29-13-15-8-6-5-7-9-15/h5-9,18H,10-14H2,1-4H3,(H,24,26) |
| InChIKey | IXISIDGYHRCBCZ-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 92.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.46 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|