C10H18N4O — CID 104923403
N-ethyl-N-methyl-2-[(3-methylimidazol-4-yl)methylamino]acetamide (PubChem CID 104923403) has the molecular formula C10H18N4O and a molecular weight of 210.28 g/mol. Its IUPAC name is N-ethyl-N-methyl-2-[(3-methylimidazol-4-yl)methylamino]acetamide.
| Compound Name | N-ethyl-N-methyl-2-[(3-methylimidazol-4-yl)methylamino]acetamide |
|---|---|
| PubChem CID | 104923403 |
| Molecular Formula | C10H18N4O |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.15 |
| IUPAC Name | N-ethyl-N-methyl-2-[(3-methylimidazol-4-yl)methylamino]acetamide |
| SMILES | CCN(C)C(=O)CNCc1cncn1C |
| InChI | InChI=1S/C10H18N4O/c1-4-13(2)10(15)7-11-5-9-6-12-8-14(9)3/h6,8,11H,4-5,7H2,1-3H3 |
| InChIKey | XBWGGGITGPBDDE-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |