C11H16BrN3O — CID 104923461
2-[(5-bromo-2-pyridinyl)methylamino]-N-ethyl-N-methylacetamide (PubChem CID 104923461) has the molecular formula C11H16BrN3O and a molecular weight of 286.17 g/mol. Its IUPAC name is 2-[(5-bromo-2-pyridinyl)methylamino]-N-ethyl-N-methylacetamide.
| Compound Name | 2-[(5-bromo-2-pyridinyl)methylamino]-N-ethyl-N-methylacetamide |
|---|---|
| PubChem CID | 104923461 |
| Molecular Formula | C11H16BrN3O |
| Molecular Weight | 286.17 g/mol |
| Exact Mass | 285.05 |
| IUPAC Name | 2-[(5-bromo-2-pyridinyl)methylamino]-N-ethyl-N-methylacetamide |
| SMILES | CCN(C)C(=O)CNCc1ccc(Br)cn1 |
| InChI | InChI=1S/C11H16BrN3O/c1-3-15(2)11(16)8-13-7-10-5-4-9(12)6-14-10/h4-6,13H,3,7-8H2,1-2H3 |
| InChIKey | GXNRBLLRYWSKMO-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.17 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |