C10H11BrO4 — CID 10492604
(1R,6R)-5-[(E)-2-bromoethenyl]-2,2-dimethoxy-7-oxabicyclo[4.1.0]hept-4-en-3-one (PubChem CID 10492604) has the molecular formula C10H11BrO4 and a molecular weight of 275.10 g/mol. Its IUPAC name is (1R,6R)-5-[(E)-2-bromoethenyl]-2,2-dimethoxy-7-oxabicyclo[4.1.0]hept-4-en-3-one.
| Compound Name | (1R,6R)-5-[(E)-2-bromoethenyl]-2,2-dimethoxy-7-oxabicyclo[4.1.0]hept-4-en-3-one |
|---|---|
| PubChem CID | 10492604 |
| Molecular Formula | C10H11BrO4 |
| Molecular Weight | 275.10 g/mol |
| Exact Mass | 273.98 |
| IUPAC Name | (1R,6R)-5-[(E)-2-bromoethenyl]-2,2-dimethoxy-7-oxabicyclo[4.1.0]hept-4-en-3-one |
| SMILES | COC1(OC)C(=O)C=C(/C=C/Br)[C@H]2O[C@H]21 |
| InChI | InChI=1S/C10H11BrO4/c1-13-10(14-2)7(12)5-6(3-4-11)8-9(10)15-8/h3-5,8-9H,1-2H3/b4-3+/t8-,9-/m1/s1 |
| InChIKey | SRUBMKUBMHNPKI-HUGTUPKYSA-N |
| XLogP | 1.16 |
| TPSA | 48.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.10 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|