C18H22O4 — CID 134901678
(1R,6S)-5,5-dimethoxy-4-(7-methyl-3-methylideneoct-6-en-1-ynyl)-7-oxabicyclo[4.1.0]hept-3-en-2-one (PubChem CID 134901678) has the molecular formula C18H22O4 and a molecular weight of 302.37 g/mol. Its IUPAC name is (1R,6S)-5,5-dimethoxy-4-(7-methyl-3-methylideneoct-6-en-1-ynyl)-7-oxabicyclo[4.1.0]hept-3-en-2-one.
| Compound Name | (1R,6S)-5,5-dimethoxy-4-(7-methyl-3-methylideneoct-6-en-1-ynyl)-7-oxabicyclo[4.1.0]hept-3-en-2-one |
|---|---|
| PubChem CID | 134901678 |
| Molecular Formula | C18H22O4 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | (1R,6S)-5,5-dimethoxy-4-(7-methyl-3-methylideneoct-6-en-1-ynyl)-7-oxabicyclo[4.1.0]hept-3-en-2-one |
| SMILES | C=C(C#CC1=CC(=O)[C@@H]2O[C@@H]2C1(OC)OC)CCC=C(C)C |
| InChI | InChI=1S/C18H22O4/c1-12(2)7-6-8-13(3)9-10-14-11-15(19)16-17(22-16)18(14,20-4)21-5/h7,11,16-17H,3,6,8H2,1-2,4-5H3/t16-,17-/m0/s1 |
| InChIKey | SVIDTCBBGHQOAI-IRXDYDNUSA-N |
| XLogP | 2.56 |
| TPSA | 48.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|