C9H12O4 — CID 91122993
5,5-dimethoxy-4-methyl-7-oxabicyclo[4.1.0]hept-3-en-2-one (PubChem CID 91122993) has the molecular formula C9H12O4 and a molecular weight of 184.19 g/mol. Its IUPAC name is 5,5-dimethoxy-4-methyl-7-oxabicyclo[4.1.0]hept-3-en-2-one.
| Compound Name | 5,5-dimethoxy-4-methyl-7-oxabicyclo[4.1.0]hept-3-en-2-one |
|---|---|
| PubChem CID | 91122993 |
| Molecular Formula | C9H12O4 |
| Molecular Weight | 184.19 g/mol |
| Exact Mass | 184.07 |
| IUPAC Name | 5,5-dimethoxy-4-methyl-7-oxabicyclo[4.1.0]hept-3-en-2-one |
| SMILES | COC1(OC)C(C)=CC(=O)C2OC21 |
| InChI | InChI=1S/C9H12O4/c1-5-4-6(10)7-8(13-7)9(5,11-2)12-3/h4,7-8H,1-3H3 |
| InChIKey | PFDXTUHVNSBIDD-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 48.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.19 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|