C11H12O6 — CID 11128398
[(1S,2S,6S)-2-acetyloxy-5-oxo-7-oxabicyclo[4.1.0]hept-3-en-3-yl]methyl acetate (PubChem CID 11128398) has the molecular formula C11H12O6 and a molecular weight of 240.21 g/mol. Its IUPAC name is [(1S,2S,6S)-2-acetyloxy-5-oxo-7-oxabicyclo[4.1.0]hept-3-en-3-yl]methyl acetate.
| Compound Name | [(1S,2S,6S)-2-acetyloxy-5-oxo-7-oxabicyclo[4.1.0]hept-3-en-3-yl]methyl acetate |
|---|---|
| PubChem CID | 11128398 |
| Molecular Formula | C11H12O6 |
| Molecular Weight | 240.21 g/mol |
| Exact Mass | 240.06 |
| IUPAC Name | [(1S,2S,6S)-2-acetyloxy-5-oxo-7-oxabicyclo[4.1.0]hept-3-en-3-yl]methyl acetate |
| SMILES | CC(=O)OCC1=CC(=O)[C@H]2O[C@H]2[C@H]1OC(C)=O |
| InChI | InChI=1S/C11H12O6/c1-5(12)15-4-7-3-8(14)10-11(17-10)9(7)16-6(2)13/h3,9-11H,4H2,1-2H3/t9-,10+,11-/m0/s1 |
| InChIKey | JFVHJJQWUXZARJ-AXFHLTTASA-N |
| XLogP | -0.24 |
| TPSA | 82.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.21 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|