C17H28OSi — CID 10492748
(6E,8E,10Z)-2-methyl-10-(trimethylsilylmethyl)dodeca-1,6,8,10-tetraen-3-one (PubChem CID 10492748) has the molecular formula C17H28OSi and a molecular weight of 276.50 g/mol. Its IUPAC name is (6E,8E,10Z)-2-methyl-10-(trimethylsilylmethyl)dodeca-1,6,8,10-tetraen-3-one.
| Compound Name | (6E,8E,10Z)-2-methyl-10-(trimethylsilylmethyl)dodeca-1,6,8,10-tetraen-3-one |
|---|---|
| PubChem CID | 10492748 |
| Molecular Formula | C17H28OSi |
| Molecular Weight | 276.50 g/mol |
| Exact Mass | 276.19 |
| IUPAC Name | (6E,8E,10Z)-2-methyl-10-(trimethylsilylmethyl)dodeca-1,6,8,10-tetraen-3-one |
| SMILES | C=C(C)C(=O)CC/C=C/C=C/C(=C/C)C[Si](C)(C)C |
| InChI | InChI=1S/C17H28OSi/c1-7-16(14-19(4,5)6)12-10-8-9-11-13-17(18)15(2)3/h7-10,12H,2,11,13-14H2,1,3-6H3/b9-8+,12-10+,16-7- |
| InChIKey | PHGZGIGFRMWXCA-VEGMGYAWSA-N |
| XLogP | 5.31 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.50 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|