About [2-[(4-methyl-1,2,5-oxadiazol-3-yl)methylamino]cyclohexyl]methanol
[2-[(4-methyl-1,2,5-oxadiazol-3-yl)methylamino]cyclohexyl]methanol (PubChem CID 104934477) has the molecular formula C11H19N3O2
and a molecular weight of 225.29 g/mol. Its IUPAC name is [2-[(4-methyl-1,2,5-oxadiazol-3-yl)methylamino]cyclohexyl]methanol.
Molecular Properties
| Compound Name | [2-[(4-methyl-1,2,5-oxadiazol-3-yl)methylamino]cyclohexyl]methanol |
| PubChem CID | 104934477 |
| Molecular Formula | C11H19N3O2 |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.15 |
| IUPAC Name | [2-[(4-methyl-1,2,5-oxadiazol-3-yl)methylamino]cyclohexyl]methanol |
| SMILES | Cc1nonc1CNC1CCCCC1CO |
| InChI | InChI=1S/C11H19N3O2/c1-8-11(14-16-13-8)6-12-10-5-3-2-4-9(10)7-15/h9-10,12,15H,2-7H2,1H3 |
| InChIKey | NICYATOYAQXJGW-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 71.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [2-[(4-methyl-1,2,5-oxadiazol-3-yl)methylamino]cyclohexyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[(4-methyl-1,2,5-oxadiazol-3-yl)methylamino]cyclohexyl]methanol?
The IUPAC name of [2-[(4-methyl-1,2,5-oxadiazol-3-yl)methylamino]cyclohexyl]methanol (CID 104934477) is [2-[(4-methyl-1,2,5-oxadiazol-3-yl)methylamino]cyclohexyl]methanol.
What is the SMILES notation for [2-[(4-methyl-1,2,5-oxadiazol-3-yl)methylamino]cyclohexyl]methanol?
The canonical SMILES for [2-[(4-methyl-1,2,5-oxadiazol-3-yl)methylamino]cyclohexyl]methanol is Cc1nonc1CNC1CCCCC1CO.
What is the InChIKey of [2-[(4-methyl-1,2,5-oxadiazol-3-yl)methylamino]cyclohexyl]methanol?
The InChIKey is NICYATOYAQXJGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19N3O2/c1-8-11(14-16-13-8)6-12-10-5-3-2-4-9(10)7-15/h9-10,12,15H,2-7H2,1H3.
What are the key properties of [2-[(4-methyl-1,2,5-oxadiazol-3-yl)methylamino]cyclohexyl]methanol?
[2-[(4-methyl-1,2,5-oxadiazol-3-yl)methylamino]cyclohexyl]methanol has a molecular weight of 225.29 g/mol, XLogP of 1.02, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[(4-methyl-1,2,5-oxadiazol-3-yl)methylamino]cyclohexyl]methanol is sourced from PubChem (CID 104934477), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).