C12H15N3O4S — CID 104934882
(2S)-2-(1H-pyrrolo[2,3-b]pyridin-3-ylsulfonylamino)pentanoic acid (PubChem CID 104934882) has the molecular formula C12H15N3O4S and a molecular weight of 297.34 g/mol. Its IUPAC name is (2S)-2-(1H-pyrrolo[2,3-b]pyridin-3-ylsulfonylamino)pentanoic acid.
| Compound Name | (2S)-2-(1H-pyrrolo[2,3-b]pyridin-3-ylsulfonylamino)pentanoic acid |
|---|---|
| PubChem CID | 104934882 |
| Molecular Formula | C12H15N3O4S |
| Molecular Weight | 297.34 g/mol |
| Exact Mass | 297.08 |
| IUPAC Name | (2S)-2-(1H-pyrrolo[2,3-b]pyridin-3-ylsulfonylamino)pentanoic acid |
| SMILES | CCC[C@H](NS(=O)(=O)c1c[nH]c2ncccc12)C(=O)O |
| InChI | InChI=1S/C12H15N3O4S/c1-2-4-9(12(16)17)15-20(18,19)10-7-14-11-8(10)5-3-6-13-11/h3,5-7,9,15H,2,4H2,1H3,(H,13,14)(H,16,17)/t9-/m0/s1 |
| InChIKey | IHEJOBCQNIZOBU-VIFPVBQESA-N |
| XLogP | 1.09 |
| TPSA | 112.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.34 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |