C16H17N3O2S — CID 142393211
N-(4-propylphenyl)-1H-pyrrolo[2,3-b]pyridine-3-sulfonamide (PubChem CID 142393211) has the molecular formula C16H17N3O2S and a molecular weight of 315.40 g/mol. Its IUPAC name is N-(4-propylphenyl)-1H-pyrrolo[2,3-b]pyridine-3-sulfonamide.
| Compound Name | N-(4-propylphenyl)-1H-pyrrolo[2,3-b]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 142393211 |
| Molecular Formula | C16H17N3O2S |
| Molecular Weight | 315.40 g/mol |
| Exact Mass | 315.10 |
| IUPAC Name | N-(4-propylphenyl)-1H-pyrrolo[2,3-b]pyridine-3-sulfonamide |
| SMILES | CCCc1ccc(NS(=O)(=O)c2c[nH]c3ncccc23)cc1 |
| InChI | InChI=1S/C16H17N3O2S/c1-2-4-12-6-8-13(9-7-12)19-22(20,21)15-11-18-16-14(15)5-3-10-17-16/h3,5-11,19H,2,4H2,1H3,(H,17,18) |
| InChIKey | DPSCEAJGHOLWPE-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.40 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |