C11H17ClN4O2S — CID 119964781
N-[3-(methylamino)propyl]-1H-pyrrolo[2,3-b]pyridine-3-sulfonamide;hydrochloride (PubChem CID 119964781) has the molecular formula C11H17ClN4O2S and a molecular weight of 304.80 g/mol. Its IUPAC name is N-[3-(methylamino)propyl]-1H-pyrrolo[2,3-b]pyridine-3-sulfonamide;hydrochloride.
| Compound Name | N-[3-(methylamino)propyl]-1H-pyrrolo[2,3-b]pyridine-3-sulfonamide;hydrochloride |
|---|---|
| PubChem CID | 119964781 |
| Molecular Formula | C11H17ClN4O2S |
| Molecular Weight | 304.80 g/mol |
| Exact Mass | 304.08 |
| IUPAC Name | N-[3-(methylamino)propyl]-1H-pyrrolo[2,3-b]pyridine-3-sulfonamide;hydrochloride |
| SMILES | CNCCCNS(=O)(=O)c1c[nH]c2ncccc12.Cl |
| InChI | InChI=1S/C11H16N4O2S.ClH/c1-12-5-3-7-15-18(16,17)10-8-14-11-9(10)4-2-6-13-11;/h2,4,6,8,12,15H,3,5,7H2,1H3,(H,13,14);1H |
| InChIKey | JHTDLWKWZUGVDR-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.80 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|