C10H17N3O4S — CID 104935418
(2R)-2-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonylamino]pentanoic acid (PubChem CID 104935418) has the molecular formula C10H17N3O4S and a molecular weight of 275.33 g/mol. Its IUPAC name is (2R)-2-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonylamino]pentanoic acid.
| Compound Name | (2R)-2-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonylamino]pentanoic acid |
|---|---|
| PubChem CID | 104935418 |
| Molecular Formula | C10H17N3O4S |
| Molecular Weight | 275.33 g/mol |
| Exact Mass | 275.09 |
| IUPAC Name | (2R)-2-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonylamino]pentanoic acid |
| SMILES | CCC[C@@H](NS(=O)(=O)c1c(C)n[nH]c1C)C(=O)O |
| InChI | InChI=1S/C10H17N3O4S/c1-4-5-8(10(14)15)13-18(16,17)9-6(2)11-12-7(9)3/h8,13H,4-5H2,1-3H3,(H,11,12)(H,14,15)/t8-/m1/s1 |
| InChIKey | PLQIBJVRJQJYSE-MRVPVSSYSA-N |
| XLogP | 0.56 |
| TPSA | 112.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.33 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |