C10H15N3O6S — CID 61145220
(2S)-2-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonylamino]pentanedioic acid (PubChem CID 61145220) has the molecular formula C10H15N3O6S and a molecular weight of 305.31 g/mol. Its IUPAC name is (2S)-2-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonylamino]pentanedioic acid.
| Compound Name | (2S)-2-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonylamino]pentanedioic acid |
|---|---|
| PubChem CID | 61145220 |
| Molecular Formula | C10H15N3O6S |
| Molecular Weight | 305.31 g/mol |
| Exact Mass | 305.07 |
| IUPAC Name | (2S)-2-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonylamino]pentanedioic acid |
| SMILES | Cc1n[nH]c(C)c1S(=O)(=O)N[C@@H](CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C10H15N3O6S/c1-5-9(6(2)12-11-5)20(18,19)13-7(10(16)17)3-4-8(14)15/h7,13H,3-4H2,1-2H3,(H,11,12)(H,14,15)(H,16,17)/t7-/m0/s1 |
| InChIKey | GEWJHKMXGBEQFM-ZETCQYMHSA-N |
| XLogP | -0.38 |
| TPSA | 149.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.31 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |