C12H22BrN3O2S — CID 106118418
N-[2-(2-bromoethyl)pentyl]-3,5-dimethyl-1H-pyrazole-4-sulfonamide (PubChem CID 106118418) has the molecular formula C12H22BrN3O2S and a molecular weight of 352.30 g/mol. Its IUPAC name is N-[2-(2-bromoethyl)pentyl]-3,5-dimethyl-1H-pyrazole-4-sulfonamide.
| Compound Name | N-[2-(2-bromoethyl)pentyl]-3,5-dimethyl-1H-pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 106118418 |
| Molecular Formula | C12H22BrN3O2S |
| Molecular Weight | 352.30 g/mol |
| Exact Mass | 351.06 |
| IUPAC Name | N-[2-(2-bromoethyl)pentyl]-3,5-dimethyl-1H-pyrazole-4-sulfonamide |
| SMILES | CCCC(CCBr)CNS(=O)(=O)c1c(C)n[nH]c1C |
| InChI | InChI=1S/C12H22BrN3O2S/c1-4-5-11(6-7-13)8-14-19(17,18)12-9(2)15-16-10(12)3/h11,14H,4-8H2,1-3H3,(H,15,16) |
| InChIKey | YTVRYKSMONEWHS-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.30 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|