C12H16F2O6 — CID 10493997
diethyl (2Z,4Z)-3,4-difluoro-2,5-dimethoxyhexa-2,4-dienedioate (PubChem CID 10493997) has the molecular formula C12H16F2O6 and a molecular weight of 294.25 g/mol. Its IUPAC name is diethyl (2Z,4Z)-3,4-difluoro-2,5-dimethoxyhexa-2,4-dienedioate.
| Compound Name | diethyl (2Z,4Z)-3,4-difluoro-2,5-dimethoxyhexa-2,4-dienedioate |
|---|---|
| PubChem CID | 10493997 |
| Molecular Formula | C12H16F2O6 |
| Molecular Weight | 294.25 g/mol |
| Exact Mass | 294.09 |
| IUPAC Name | diethyl (2Z,4Z)-3,4-difluoro-2,5-dimethoxyhexa-2,4-dienedioate |
| SMILES | CCOC(=O)/C(OC)=C(F)\C(F)=C(\OC)C(=O)OCC |
| InChI | InChI=1S/C12H16F2O6/c1-5-19-11(15)9(17-3)7(13)8(14)10(18-4)12(16)20-6-2/h5-6H2,1-4H3/b9-7-,10-8- |
| InChIKey | SCOAKJGNDYSCSX-XOHWUJONSA-N |
| XLogP | 1.77 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.25 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|