C17H27N3 — CID 104943385
(1S)-1-[3-(3,5-dimethyl-1-adamantyl)imidazol-4-yl]ethanamine (PubChem CID 104943385) has the molecular formula C17H27N3 and a molecular weight of 273.42 g/mol. Its IUPAC name is (1S)-1-[3-(3,5-dimethyl-1-adamantyl)imidazol-4-yl]ethanamine.
| Compound Name | (1S)-1-[3-(3,5-dimethyl-1-adamantyl)imidazol-4-yl]ethanamine |
|---|---|
| PubChem CID | 104943385 |
| Molecular Formula | C17H27N3 |
| Molecular Weight | 273.42 g/mol |
| Exact Mass | 273.22 |
| IUPAC Name | (1S)-1-[3-(3,5-dimethyl-1-adamantyl)imidazol-4-yl]ethanamine |
| SMILES | C[C@H](N)c1cncn1C12CC3CC(C)(CC(C)(C3)C1)C2 |
| InChI | InChI=1S/C17H27N3/c1-12(18)14-7-19-11-20(14)17-6-13-4-15(2,9-17)8-16(3,5-13)10-17/h7,11-13H,4-6,8-10,18H2,1-3H3/t12-,13?,15?,16?,17?/m0/s1 |
| InChIKey | HKWKBCQHTMHYME-FXSPDVNBSA-N |
| XLogP | 3.61 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.42 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |