C18H18N4O — CID 10494868
2-morpholin-4-yl-3-phenyl-1,7-naphthyridin-4-amine (PubChem CID 10494868) has the molecular formula C18H18N4O and a molecular weight of 306.37 g/mol. Its IUPAC name is 2-morpholin-4-yl-3-phenyl-1,7-naphthyridin-4-amine.
| Compound Name | 2-morpholin-4-yl-3-phenyl-1,7-naphthyridin-4-amine |
|---|---|
| PubChem CID | 10494868 |
| Molecular Formula | C18H18N4O |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.15 |
| IUPAC Name | 2-morpholin-4-yl-3-phenyl-1,7-naphthyridin-4-amine |
| SMILES | Nc1c(-c2ccccc2)c(N2CCOCC2)nc2cnccc12 |
| InChI | InChI=1S/C18H18N4O/c19-17-14-6-7-20-12-15(14)21-18(22-8-10-23-11-9-22)16(17)13-4-2-1-3-5-13/h1-7,12H,8-11H2,(H2,19,21) |
| InChIKey | ONICTUPENPBYHS-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 64.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |