C19H17NOS — CID 10494953
6-(4-methoxyphenyl)-2,7-dimethylthieno[2,3-e]indole (PubChem CID 10494953) has the molecular formula C19H17NOS and a molecular weight of 307.42 g/mol. Its IUPAC name is 6-(4-methoxyphenyl)-2,7-dimethylthieno[2,3-e]indole.
| Compound Name | 6-(4-methoxyphenyl)-2,7-dimethylthieno[2,3-e]indole |
|---|---|
| PubChem CID | 10494953 |
| Molecular Formula | C19H17NOS |
| Molecular Weight | 307.42 g/mol |
| Exact Mass | 307.10 |
| IUPAC Name | 6-(4-methoxyphenyl)-2,7-dimethylthieno[2,3-e]indole |
| SMILES | COc1ccc(-n2c(C)cc3c4sc(C)cc4ccc32)cc1 |
| InChI | InChI=1S/C19H17NOS/c1-12-10-17-18(9-4-14-11-13(2)22-19(14)17)20(12)15-5-7-16(21-3)8-6-15/h4-11H,1-3H3 |
| InChIKey | RKVGCUVCCXADIN-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 14.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.42 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |