About (4R)-6-methyl-2-(1,3-thiazol-5-yl)-3,4-dihydro-2H-chromen-4-ol
(4R)-6-methyl-2-(1,3-thiazol-5-yl)-3,4-dihydro-2H-chromen-4-ol (PubChem CID 104950265) has the molecular formula C13H13NO2S
and a molecular weight of 247.32 g/mol. Its IUPAC name is (4R)-6-methyl-2-(1,3-thiazol-5-yl)-3,4-dihydro-2H-chromen-4-ol.
Molecular Properties
| Compound Name | (4R)-6-methyl-2-(1,3-thiazol-5-yl)-3,4-dihydro-2H-chromen-4-ol |
| PubChem CID | 104950265 |
| Molecular Formula | C13H13NO2S |
| Molecular Weight | 247.32 g/mol |
| Exact Mass | 247.07 |
| IUPAC Name | (4R)-6-methyl-2-(1,3-thiazol-5-yl)-3,4-dihydro-2H-chromen-4-ol |
| SMILES | Cc1ccc2c(c1)[C@H](O)CC(c1cncs1)O2 |
| InChI | InChI=1S/C13H13NO2S/c1-8-2-3-11-9(4-8)10(15)5-12(16-11)13-6-14-7-17-13/h2-4,6-7,10,12,15H,5H2,1H3/t10-,12?/m1/s1 |
| InChIKey | BQHKEKFOYURCRM-RWANSRKNSA-N |
| XLogP | 3.01 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.32 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (4R)-6-methyl-2-(1,3-thiazol-5-yl)-3,4-dihydro-2H-chromen-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-6-methyl-2-(1,3-thiazol-5-yl)-3,4-dihydro-2H-chromen-4-ol?
The IUPAC name of (4R)-6-methyl-2-(1,3-thiazol-5-yl)-3,4-dihydro-2H-chromen-4-ol (CID 104950265) is (4R)-6-methyl-2-(1,3-thiazol-5-yl)-3,4-dihydro-2H-chromen-4-ol.
What is the SMILES notation for (4R)-6-methyl-2-(1,3-thiazol-5-yl)-3,4-dihydro-2H-chromen-4-ol?
The canonical SMILES for (4R)-6-methyl-2-(1,3-thiazol-5-yl)-3,4-dihydro-2H-chromen-4-ol is Cc1ccc2c(c1)[C@H](O)CC(c1cncs1)O2.
What is the InChIKey of (4R)-6-methyl-2-(1,3-thiazol-5-yl)-3,4-dihydro-2H-chromen-4-ol?
The InChIKey is BQHKEKFOYURCRM-RWANSRKNSA-N. The full InChI is InChI=1S/C13H13NO2S/c1-8-2-3-11-9(4-8)10(15)5-12(16-11)13-6-14-7-17-13/h2-4,6-7,10,12,15H,5H2,1H3/t10-,12?/m1/s1.
What are the key properties of (4R)-6-methyl-2-(1,3-thiazol-5-yl)-3,4-dihydro-2H-chromen-4-ol?
(4R)-6-methyl-2-(1,3-thiazol-5-yl)-3,4-dihydro-2H-chromen-4-ol has a molecular weight of 247.32 g/mol, XLogP of 3.01, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-6-methyl-2-(1,3-thiazol-5-yl)-3,4-dihydro-2H-chromen-4-ol is sourced from PubChem (CID 104950265), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).