C15H20N2O3 — CID 104953006
N-[(1S,2S)-2-hydroxycyclohexyl]-N'-(4-methylphenyl)oxamide (PubChem CID 104953006) has the molecular formula C15H20N2O3 and a molecular weight of 276.34 g/mol. Its IUPAC name is N-[(1S,2S)-2-hydroxycyclohexyl]-N'-(4-methylphenyl)oxamide.
| Compound Name | N-[(1S,2S)-2-hydroxycyclohexyl]-N'-(4-methylphenyl)oxamide |
|---|---|
| PubChem CID | 104953006 |
| Molecular Formula | C15H20N2O3 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.15 |
| IUPAC Name | N-[(1S,2S)-2-hydroxycyclohexyl]-N'-(4-methylphenyl)oxamide |
| SMILES | Cc1ccc(NC(=O)C(=O)N[C@H]2CCCC[C@@H]2O)cc1 |
| InChI | InChI=1S/C15H20N2O3/c1-10-6-8-11(9-7-10)16-14(19)15(20)17-12-4-2-3-5-13(12)18/h6-9,12-13,18H,2-5H2,1H3,(H,16,19)(H,17,20)/t12-,13-/m0/s1 |
| InChIKey | BWVYNDHLMKNZMH-STQMWFEESA-N |
| XLogP | 1.35 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|