C11H20N2O — CID 104954562
3-[[(1R,2R)-2-hydroxycyclohexyl]-methylamino]butanenitrile (PubChem CID 104954562) has the molecular formula C11H20N2O and a molecular weight of 196.29 g/mol. Its IUPAC name is 3-[[(1R,2R)-2-hydroxycyclohexyl]-methylamino]butanenitrile.
| Compound Name | 3-[[(1R,2R)-2-hydroxycyclohexyl]-methylamino]butanenitrile |
|---|---|
| PubChem CID | 104954562 |
| Molecular Formula | C11H20N2O |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.16 |
| IUPAC Name | 3-[[(1R,2R)-2-hydroxycyclohexyl]-methylamino]butanenitrile |
| SMILES | CC(CC#N)N(C)[C@@H]1CCCC[C@H]1O |
| InChI | InChI=1S/C11H20N2O/c1-9(7-8-12)13(2)10-5-3-4-6-11(10)14/h9-11,14H,3-7H2,1-2H3/t9?,10-,11-/m1/s1 |
| InChIKey | OTSSVRKEPARWQZ-FHZGLPGMSA-N |
| XLogP | 1.52 |
| TPSA | 47.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |