C11H20N2O3 — CID 104954989
2-(2-methoxyethoxy)-N-(1,2,3,6-tetrahydropyridin-4-ylmethyl)acetamide (PubChem CID 104954989) has the molecular formula C11H20N2O3 and a molecular weight of 228.29 g/mol. Its IUPAC name is 2-(2-methoxyethoxy)-N-(1,2,3,6-tetrahydropyridin-4-ylmethyl)acetamide.
| Compound Name | 2-(2-methoxyethoxy)-N-(1,2,3,6-tetrahydropyridin-4-ylmethyl)acetamide |
|---|---|
| PubChem CID | 104954989 |
| Molecular Formula | C11H20N2O3 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.15 |
| IUPAC Name | 2-(2-methoxyethoxy)-N-(1,2,3,6-tetrahydropyridin-4-ylmethyl)acetamide |
| SMILES | COCCOCC(=O)NCC1=CCNCC1 |
| InChI | InChI=1S/C11H20N2O3/c1-15-6-7-16-9-11(14)13-8-10-2-4-12-5-3-10/h2,12H,3-9H2,1H3,(H,13,14) |
| InChIKey | VQULNUQUAIVYEQ-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|