C17H25NO3 — CID 104956768
3-(2,6-dimethylphenoxy)-N-[(1S,2S)-2-hydroxycyclohexyl]propanamide (PubChem CID 104956768) has the molecular formula C17H25NO3 and a molecular weight of 291.39 g/mol. Its IUPAC name is 3-(2,6-dimethylphenoxy)-N-[(1S,2S)-2-hydroxycyclohexyl]propanamide.
| Compound Name | 3-(2,6-dimethylphenoxy)-N-[(1S,2S)-2-hydroxycyclohexyl]propanamide |
|---|---|
| PubChem CID | 104956768 |
| Molecular Formula | C17H25NO3 |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.18 |
| IUPAC Name | 3-(2,6-dimethylphenoxy)-N-[(1S,2S)-2-hydroxycyclohexyl]propanamide |
| SMILES | Cc1cccc(C)c1OCCC(=O)N[C@H]1CCCC[C@@H]1O |
| InChI | InChI=1S/C17H25NO3/c1-12-6-5-7-13(2)17(12)21-11-10-16(20)18-14-8-3-4-9-15(14)19/h5-7,14-15,19H,3-4,8-11H2,1-2H3,(H,18,20)/t14-,15-/m0/s1 |
| InChIKey | SZBHBAHDEWEMMR-GJZGRUSLSA-N |
| XLogP | 2.49 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |