C16H26N2O — CID 104958196
2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-3-phenylbutan-1-amine (PubChem CID 104958196) has the molecular formula C16H26N2O and a molecular weight of 262.40 g/mol. Its IUPAC name is 2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-3-phenylbutan-1-amine.
| Compound Name | 2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-3-phenylbutan-1-amine |
|---|---|
| PubChem CID | 104958196 |
| Molecular Formula | C16H26N2O |
| Molecular Weight | 262.40 g/mol |
| Exact Mass | 262.20 |
| IUPAC Name | 2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-3-phenylbutan-1-amine |
| SMILES | CC(c1ccccc1)C(CN)N1C[C@@H](C)O[C@@H](C)C1 |
| InChI | InChI=1S/C16H26N2O/c1-12-10-18(11-13(2)19-12)16(9-17)14(3)15-7-5-4-6-8-15/h4-8,12-14,16H,9-11,17H2,1-3H3/t12-,13+,14?,16? |
| InChIKey | IYVXKBQCWMRGSG-KKNUOHPOSA-N |
| XLogP | 2.23 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.40 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |