C13H23NO3 — CID 104960586
3-[[(2R,6S)-2,6-dimethylmorpholin-4-yl]methyl]oxane-3-carbaldehyde (PubChem CID 104960586) has the molecular formula C13H23NO3 and a molecular weight of 241.33 g/mol. Its IUPAC name is 3-[[(2R,6S)-2,6-dimethylmorpholin-4-yl]methyl]oxane-3-carbaldehyde.
| Compound Name | 3-[[(2R,6S)-2,6-dimethylmorpholin-4-yl]methyl]oxane-3-carbaldehyde |
|---|---|
| PubChem CID | 104960586 |
| Molecular Formula | C13H23NO3 |
| Molecular Weight | 241.33 g/mol |
| Exact Mass | 241.17 |
| IUPAC Name | 3-[[(2R,6S)-2,6-dimethylmorpholin-4-yl]methyl]oxane-3-carbaldehyde |
| SMILES | C[C@@H]1CN(CC2(C=O)CCCOC2)C[C@H](C)O1 |
| InChI | InChI=1S/C13H23NO3/c1-11-6-14(7-12(2)17-11)8-13(9-15)4-3-5-16-10-13/h9,11-12H,3-8,10H2,1-2H3/t11-,12+,13? |
| InChIKey | KBCCXKJDMZGDCZ-FUNVUKJBSA-N |
| XLogP | 1.09 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.33 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|