C10H20N2O3S — CID 104961415
(2S,6R)-2,6-dimethyl-4-pyrrolidin-3-ylsulfonylmorpholine (PubChem CID 104961415) has the molecular formula C10H20N2O3S and a molecular weight of 248.35 g/mol. Its IUPAC name is (2S,6R)-2,6-dimethyl-4-pyrrolidin-3-ylsulfonylmorpholine.
| Compound Name | (2S,6R)-2,6-dimethyl-4-pyrrolidin-3-ylsulfonylmorpholine |
|---|---|
| PubChem CID | 104961415 |
| Molecular Formula | C10H20N2O3S |
| Molecular Weight | 248.35 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | (2S,6R)-2,6-dimethyl-4-pyrrolidin-3-ylsulfonylmorpholine |
| SMILES | C[C@@H]1CN(S(=O)(=O)C2CCNC2)C[C@H](C)O1 |
| InChI | InChI=1S/C10H20N2O3S/c1-8-6-12(7-9(2)15-8)16(13,14)10-3-4-11-5-10/h8-11H,3-7H2,1-2H3/t8-,9+,10? |
| InChIKey | DLUFDGOLAXEBPL-ULKQDVFKSA-N |
| XLogP | -0.21 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.35 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |