C9H18N2O2S — CID 126990592
3-(3,3-dimethylazetidin-1-yl)sulfonylpyrrolidine (PubChem CID 126990592) has the molecular formula C9H18N2O2S and a molecular weight of 218.32 g/mol. Its IUPAC name is 3-(3,3-dimethylazetidin-1-yl)sulfonylpyrrolidine.
| Compound Name | 3-(3,3-dimethylazetidin-1-yl)sulfonylpyrrolidine |
|---|---|
| PubChem CID | 126990592 |
| Molecular Formula | C9H18N2O2S |
| Molecular Weight | 218.32 g/mol |
| Exact Mass | 218.11 |
| IUPAC Name | 3-(3,3-dimethylazetidin-1-yl)sulfonylpyrrolidine |
| SMILES | CC1(C)CN(S(=O)(=O)C2CCNC2)C1 |
| InChI | InChI=1S/C9H18N2O2S/c1-9(2)6-11(7-9)14(12,13)8-3-4-10-5-8/h8,10H,3-7H2,1-2H3 |
| InChIKey | QKEXMHFMSAVVAQ-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.32 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |