C11H21N3O3S — CID 113402662
N-(1-pyrrolidin-3-ylsulfonylpiperidin-4-yl)acetamide (PubChem CID 113402662) has the molecular formula C11H21N3O3S and a molecular weight of 275.37 g/mol. Its IUPAC name is N-(1-pyrrolidin-3-ylsulfonylpiperidin-4-yl)acetamide.
| Compound Name | N-(1-pyrrolidin-3-ylsulfonylpiperidin-4-yl)acetamide |
|---|---|
| PubChem CID | 113402662 |
| Molecular Formula | C11H21N3O3S |
| Molecular Weight | 275.37 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | N-(1-pyrrolidin-3-ylsulfonylpiperidin-4-yl)acetamide |
| SMILES | CC(=O)NC1CCN(S(=O)(=O)C2CCNC2)CC1 |
| InChI | InChI=1S/C11H21N3O3S/c1-9(15)13-10-3-6-14(7-4-10)18(16,17)11-2-5-12-8-11/h10-12H,2-8H2,1H3,(H,13,15) |
| InChIKey | SRTLLMZXGLYXAU-UHFFFAOYSA-N |
| XLogP | -0.72 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.37 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |