C17H32N4O4S — CID 167935622
1-ethyl-3-[1-(oxan-4-ylsulfonyl)piperidin-4-yl]-1-pyrrolidin-3-ylurea (PubChem CID 167935622) has the molecular formula C17H32N4O4S and a molecular weight of 388.53 g/mol. Its IUPAC name is 1-ethyl-3-[1-(oxan-4-ylsulfonyl)piperidin-4-yl]-1-pyrrolidin-3-ylurea.
| Compound Name | 1-ethyl-3-[1-(oxan-4-ylsulfonyl)piperidin-4-yl]-1-pyrrolidin-3-ylurea |
|---|---|
| PubChem CID | 167935622 |
| Molecular Formula | C17H32N4O4S |
| Molecular Weight | 388.53 g/mol |
| Exact Mass | 388.21 |
| IUPAC Name | 1-ethyl-3-[1-(oxan-4-ylsulfonyl)piperidin-4-yl]-1-pyrrolidin-3-ylurea |
| SMILES | CCN(C(=O)NC1CCN(S(=O)(=O)C2CCOCC2)CC1)C1CCNC1 |
| InChI | InChI=1S/C17H32N4O4S/c1-2-21(15-3-8-18-13-15)17(22)19-14-4-9-20(10-5-14)26(23,24)16-6-11-25-12-7-16/h14-16,18H,2-13H2,1H3,(H,19,22) |
| InChIKey | MCTVZDVYPQAEKT-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.53 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |