C12H21N3O4S — CID 83104809
N-cyclopropyl-4-pyrrolidin-3-ylsulfonylmorpholine-3-carboxamide (PubChem CID 83104809) has the molecular formula C12H21N3O4S and a molecular weight of 303.38 g/mol. Its IUPAC name is N-cyclopropyl-4-pyrrolidin-3-ylsulfonylmorpholine-3-carboxamide.
| Compound Name | N-cyclopropyl-4-pyrrolidin-3-ylsulfonylmorpholine-3-carboxamide |
|---|---|
| PubChem CID | 83104809 |
| Molecular Formula | C12H21N3O4S |
| Molecular Weight | 303.38 g/mol |
| Exact Mass | 303.13 |
| IUPAC Name | N-cyclopropyl-4-pyrrolidin-3-ylsulfonylmorpholine-3-carboxamide |
| SMILES | O=C(NC1CC1)C1COCCN1S(=O)(=O)C1CCNC1 |
| InChI | InChI=1S/C12H21N3O4S/c16-12(14-9-1-2-9)11-8-19-6-5-15(11)20(17,18)10-3-4-13-7-10/h9-11,13H,1-8H2,(H,14,16) |
| InChIKey | RXQPZWOVZKOVOL-UHFFFAOYSA-N |
| XLogP | -1.34 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.38 |
| LogP ≤ 5 | -1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |