C10H19N3O3S — CID 102893007
1-methyl-4-pyrrolidin-3-ylsulfonyl-1,4-diazepan-2-one (PubChem CID 102893007) has the molecular formula C10H19N3O3S and a molecular weight of 261.35 g/mol. Its IUPAC name is 1-methyl-4-pyrrolidin-3-ylsulfonyl-1,4-diazepan-2-one.
| Compound Name | 1-methyl-4-pyrrolidin-3-ylsulfonyl-1,4-diazepan-2-one |
|---|---|
| PubChem CID | 102893007 |
| Molecular Formula | C10H19N3O3S |
| Molecular Weight | 261.35 g/mol |
| Exact Mass | 261.11 |
| IUPAC Name | 1-methyl-4-pyrrolidin-3-ylsulfonyl-1,4-diazepan-2-one |
| SMILES | CN1CCCN(S(=O)(=O)C2CCNC2)CC1=O |
| InChI | InChI=1S/C10H19N3O3S/c1-12-5-2-6-13(8-10(12)14)17(15,16)9-3-4-11-7-9/h9,11H,2-8H2,1H3 |
| InChIKey | GQRDBRCUHOMTEK-UHFFFAOYSA-N |
| XLogP | -1.16 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.35 |
| LogP ≤ 5 | -1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |