C12H24N2O3S — CID 54973979
2,6-dimethyl-4-(piperidin-4-ylmethylsulfonyl)morpholine (PubChem CID 54973979) has the molecular formula C12H24N2O3S and a molecular weight of 276.40 g/mol. Its IUPAC name is 2,6-dimethyl-4-(piperidin-4-ylmethylsulfonyl)morpholine.
| Compound Name | 2,6-dimethyl-4-(piperidin-4-ylmethylsulfonyl)morpholine |
|---|---|
| PubChem CID | 54973979 |
| Molecular Formula | C12H24N2O3S |
| Molecular Weight | 276.40 g/mol |
| Exact Mass | 276.15 |
| IUPAC Name | 2,6-dimethyl-4-(piperidin-4-ylmethylsulfonyl)morpholine |
| SMILES | CC1CN(S(=O)(=O)CC2CCNCC2)CC(C)O1 |
| InChI | InChI=1S/C12H24N2O3S/c1-10-7-14(8-11(2)17-10)18(15,16)9-12-3-5-13-6-4-12/h10-13H,3-9H2,1-2H3 |
| InChIKey | FEXBQLFDEJZJNL-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.40 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |