C13H19NO3S — CID 104962462
(1S,6R)-6-(3-methylthiomorpholine-4-carbonyl)cyclohex-3-ene-1-carboxylic acid (PubChem CID 104962462) has the molecular formula C13H19NO3S and a molecular weight of 269.37 g/mol. Its IUPAC name is (1S,6R)-6-(3-methylthiomorpholine-4-carbonyl)cyclohex-3-ene-1-carboxylic acid.
| Compound Name | (1S,6R)-6-(3-methylthiomorpholine-4-carbonyl)cyclohex-3-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 104962462 |
| Molecular Formula | C13H19NO3S |
| Molecular Weight | 269.37 g/mol |
| Exact Mass | 269.11 |
| IUPAC Name | (1S,6R)-6-(3-methylthiomorpholine-4-carbonyl)cyclohex-3-ene-1-carboxylic acid |
| SMILES | CC1CSCCN1C(=O)[C@@H]1CC=CC[C@@H]1C(=O)O |
| InChI | InChI=1S/C13H19NO3S/c1-9-8-18-7-6-14(9)12(15)10-4-2-3-5-11(10)13(16)17/h2-3,9-11H,4-8H2,1H3,(H,16,17)/t9?,10-,11+/m1/s1 |
| InChIKey | YRHXSZIIHRNAPJ-ZOCYIJKUSA-N |
| XLogP | 1.62 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.37 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|