C14H21N3O2 — CID 104963301
(1S,6R)-6-(5-tert-butyl-2-methyl-1,2,4-triazol-3-yl)cyclohex-3-ene-1-carboxylic acid (PubChem CID 104963301) has the molecular formula C14H21N3O2 and a molecular weight of 263.34 g/mol. Its IUPAC name is (1S,6R)-6-(5-tert-butyl-2-methyl-1,2,4-triazol-3-yl)cyclohex-3-ene-1-carboxylic acid.
| Compound Name | (1S,6R)-6-(5-tert-butyl-2-methyl-1,2,4-triazol-3-yl)cyclohex-3-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 104963301 |
| Molecular Formula | C14H21N3O2 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.16 |
| IUPAC Name | (1S,6R)-6-(5-tert-butyl-2-methyl-1,2,4-triazol-3-yl)cyclohex-3-ene-1-carboxylic acid |
| SMILES | Cn1nc(C(C)(C)C)nc1[C@@H]1CC=CC[C@@H]1C(=O)O |
| InChI | InChI=1S/C14H21N3O2/c1-14(2,3)13-15-11(17(4)16-13)9-7-5-6-8-10(9)12(18)19/h5-6,9-10H,7-8H2,1-4H3,(H,18,19)/t9-,10+/m1/s1 |
| InChIKey | ASKUQWQNBIIGCI-ZJUUUORDSA-N |
| XLogP | 2.25 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|