C11H16N2O3 — CID 104963576
6-hydroxy-1-(4-methylcyclohexyl)pyrimidine-2,4-dione (PubChem CID 104963576) has the molecular formula C11H16N2O3 and a molecular weight of 224.26 g/mol. Its IUPAC name is 6-hydroxy-1-(4-methylcyclohexyl)pyrimidine-2,4-dione.
| Compound Name | 6-hydroxy-1-(4-methylcyclohexyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 104963576 |
| Molecular Formula | C11H16N2O3 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.12 |
| IUPAC Name | 6-hydroxy-1-(4-methylcyclohexyl)pyrimidine-2,4-dione |
| SMILES | CC1CCC(n2c(O)cc(=O)[nH]c2=O)CC1 |
| InChI | InChI=1S/C11H16N2O3/c1-7-2-4-8(5-3-7)13-10(15)6-9(14)12-11(13)16/h6-8,15H,2-5H2,1H3,(H,12,14,16) |
| InChIKey | QUUKAWLDQBLIJV-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 75.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |