C11H17N3O2S — CID 114123023
6-amino-1-(4-methylsulfanylcyclohexyl)pyrimidine-2,4-dione (PubChem CID 114123023) has the molecular formula C11H17N3O2S and a molecular weight of 255.34 g/mol. Its IUPAC name is 6-amino-1-(4-methylsulfanylcyclohexyl)pyrimidine-2,4-dione.
| Compound Name | 6-amino-1-(4-methylsulfanylcyclohexyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 114123023 |
| Molecular Formula | C11H17N3O2S |
| Molecular Weight | 255.34 g/mol |
| Exact Mass | 255.10 |
| IUPAC Name | 6-amino-1-(4-methylsulfanylcyclohexyl)pyrimidine-2,4-dione |
| SMILES | CSC1CCC(n2c(N)cc(=O)[nH]c2=O)CC1 |
| InChI | InChI=1S/C11H17N3O2S/c1-17-8-4-2-7(3-5-8)14-9(12)6-10(15)13-11(14)16/h6-8H,2-5,12H2,1H3,(H,13,15,16) |
| InChIKey | HXQLIELGOCUNCF-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 80.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.34 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |