About CID 10497010
CID 10497010 (PubChem CID 10497010) has the molecular formula C17H20O3PS
and a molecular weight of 335.39 g/mol.
Molecular Properties
| Compound Name | CID 10497010 |
| PubChem CID | 10497010 |
| Molecular Formula | C17H20O3PS |
| Molecular Weight | 335.39 g/mol |
| Exact Mass | 335.09 |
| IUPAC Name | — |
| SMILES | COP(=O)([CH]c1ccc(C)cc1Sc1ccc(C)cc1)OC |
| InChI | InChI=1S/C17H20O3PS/c1-13-6-9-16(10-7-13)22-17-11-14(2)5-8-15(17)12-21(18,19-3)20-4/h5-12H,1-4H3 |
| InChIKey | CVESUZCXSVAZQY-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 335.39 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze CID 10497010 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 10497010?
The IUPAC name of CID 10497010 (CID 10497010) is not available.
What is the SMILES notation for CID 10497010?
The canonical SMILES for CID 10497010 is COP(=O)([CH]c1ccc(C)cc1Sc1ccc(C)cc1)OC.
What is the InChIKey of CID 10497010?
The InChIKey is CVESUZCXSVAZQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20O3PS/c1-13-6-9-16(10-7-13)22-17-11-14(2)5-8-15(17)12-21(18,19-3)20-4/h5-12H,1-4H3.
What are the key properties of CID 10497010?
CID 10497010 has a molecular weight of 335.39 g/mol, XLogP of 5.45, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 10497010 is sourced from PubChem (CID 10497010), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).