C22H28N2O — CID 10497117
(1R,4S)-4-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-4-methyl-N,N-bis(prop-2-enyl)-1H-naphthalen-1-amine (PubChem CID 10497117) has the molecular formula C22H28N2O and a molecular weight of 336.48 g/mol. Its IUPAC name is (1R,4S)-4-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-4-methyl-N,N-bis(prop-2-enyl)-1H-naphthalen-1-amine.
| Compound Name | (1R,4S)-4-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-4-methyl-N,N-bis(prop-2-enyl)-1H-naphthalen-1-amine |
|---|---|
| PubChem CID | 10497117 |
| Molecular Formula | C22H28N2O |
| Molecular Weight | 336.48 g/mol |
| Exact Mass | 336.22 |
| IUPAC Name | (1R,4S)-4-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-4-methyl-N,N-bis(prop-2-enyl)-1H-naphthalen-1-amine |
| SMILES | C=CCN(CC=C)[C@@H]1C=C[C@](C)(C2=NC(C)(C)CO2)c2ccccc21 |
| InChI | InChI=1S/C22H28N2O/c1-6-14-24(15-7-2)19-12-13-22(5,18-11-9-8-10-17(18)19)20-23-21(3,4)16-25-20/h6-13,19H,1-2,14-16H2,3-5H3/t19-,22+/m1/s1 |
| InChIKey | IQCFMERVQTYJBV-KNQAVFIVSA-N |
| XLogP | 4.44 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.48 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|