C13H17F2O4PS — CID 10497205
[(E)-3-diethoxyphosphoryl-3,3-difluoroprop-1-enyl]sulfinylbenzene (PubChem CID 10497205) has the molecular formula C13H17F2O4PS and a molecular weight of 338.31 g/mol. Its IUPAC name is [(E)-3-diethoxyphosphoryl-3,3-difluoroprop-1-enyl]sulfinylbenzene.
| Compound Name | [(E)-3-diethoxyphosphoryl-3,3-difluoroprop-1-enyl]sulfinylbenzene |
|---|---|
| PubChem CID | 10497205 |
| Molecular Formula | C13H17F2O4PS |
| Molecular Weight | 338.31 g/mol |
| Exact Mass | 338.06 |
| IUPAC Name | [(E)-3-diethoxyphosphoryl-3,3-difluoroprop-1-enyl]sulfinylbenzene |
| SMILES | CCOP(=O)(OCC)C(F)(F)/C=C/S(=O)c1ccccc1 |
| InChI | InChI=1S/C13H17F2O4PS/c1-3-18-20(16,19-4-2)13(14,15)10-11-21(17)12-8-6-5-7-9-12/h5-11H,3-4H2,1-2H3/b11-10+ |
| InChIKey | OHJSBNMZVJMJIN-ZHACJKMWSA-N |
| XLogP | 4.17 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.31 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|