C13H18N4O3 — CID 104973145
5-nitro-2-[2-[(2R)-pyrrolidin-2-yl]ethylamino]benzamide (PubChem CID 104973145) has the molecular formula C13H18N4O3 and a molecular weight of 278.31 g/mol. Its IUPAC name is 5-nitro-2-[2-[(2R)-pyrrolidin-2-yl]ethylamino]benzamide.
| Compound Name | 5-nitro-2-[2-[(2R)-pyrrolidin-2-yl]ethylamino]benzamide |
|---|---|
| PubChem CID | 104973145 |
| Molecular Formula | C13H18N4O3 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.14 |
| IUPAC Name | 5-nitro-2-[2-[(2R)-pyrrolidin-2-yl]ethylamino]benzamide |
| SMILES | NC(=O)c1cc([N+](=O)[O-])ccc1NCC[C@H]1CCCN1 |
| InChI | InChI=1S/C13H18N4O3/c14-13(18)11-8-10(17(19)20)3-4-12(11)16-7-5-9-2-1-6-15-9/h3-4,8-9,15-16H,1-2,5-7H2,(H2,14,18)/t9-/m1/s1 |
| InChIKey | FPPYBGSNRBODEK-SECBINFHSA-N |
| XLogP | 1.25 |
| TPSA | 110.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|