C7H17N3O3S — CID 104978123
(3R,4R)-3-[ethylsulfamoyl(methyl)amino]-4-hydroxypyrrolidine (PubChem CID 104978123) has the molecular formula C7H17N3O3S and a molecular weight of 223.30 g/mol. Its IUPAC name is (3R,4R)-3-[ethylsulfamoyl(methyl)amino]-4-hydroxypyrrolidine.
| Compound Name | (3R,4R)-3-[ethylsulfamoyl(methyl)amino]-4-hydroxypyrrolidine |
|---|---|
| PubChem CID | 104978123 |
| Molecular Formula | C7H17N3O3S |
| Molecular Weight | 223.30 g/mol |
| Exact Mass | 223.10 |
| IUPAC Name | (3R,4R)-3-[ethylsulfamoyl(methyl)amino]-4-hydroxypyrrolidine |
| SMILES | CCNS(=O)(=O)N(C)[C@@H]1CNC[C@H]1O |
| InChI | InChI=1S/C7H17N3O3S/c1-3-9-14(12,13)10(2)6-4-8-5-7(6)11/h6-9,11H,3-5H2,1-2H3/t6-,7-/m1/s1 |
| InChIKey | SSQGNVTZDXHADY-RNFRBKRXSA-N |
| XLogP | -1.89 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.30 |
| LogP ≤ 5 | -1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |