C12H17F2N3O — CID 104982418
1-(2,2-difluoroethyl)-N-[(3S)-piperidin-3-yl]pyrrole-2-carboxamide (PubChem CID 104982418) has the molecular formula C12H17F2N3O and a molecular weight of 257.28 g/mol. Its IUPAC name is 1-(2,2-difluoroethyl)-N-[(3S)-piperidin-3-yl]pyrrole-2-carboxamide.
| Compound Name | 1-(2,2-difluoroethyl)-N-[(3S)-piperidin-3-yl]pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 104982418 |
| Molecular Formula | C12H17F2N3O |
| Molecular Weight | 257.28 g/mol |
| Exact Mass | 257.13 |
| IUPAC Name | 1-(2,2-difluoroethyl)-N-[(3S)-piperidin-3-yl]pyrrole-2-carboxamide |
| SMILES | O=C(N[C@H]1CCCNC1)c1cccn1CC(F)F |
| InChI | InChI=1S/C12H17F2N3O/c13-11(14)8-17-6-2-4-10(17)12(18)16-9-3-1-5-15-7-9/h2,4,6,9,11,15H,1,3,5,7-8H2,(H,16,18)/t9-/m0/s1 |
| InChIKey | BVNGJBLHNXEKDL-VIFPVBQESA-N |
| XLogP | 1.24 |
| TPSA | 46.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.28 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |