C14H19F2N3O — CID 107486961
1-(2,2-difluoroethyl)-N-[2-(1,2,3,6-tetrahydropyridin-4-yl)ethyl]pyrrole-2-carboxamide (PubChem CID 107486961) has the molecular formula C14H19F2N3O and a molecular weight of 283.32 g/mol. Its IUPAC name is 1-(2,2-difluoroethyl)-N-[2-(1,2,3,6-tetrahydropyridin-4-yl)ethyl]pyrrole-2-carboxamide.
| Compound Name | 1-(2,2-difluoroethyl)-N-[2-(1,2,3,6-tetrahydropyridin-4-yl)ethyl]pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 107486961 |
| Molecular Formula | C14H19F2N3O |
| Molecular Weight | 283.32 g/mol |
| Exact Mass | 283.15 |
| IUPAC Name | 1-(2,2-difluoroethyl)-N-[2-(1,2,3,6-tetrahydropyridin-4-yl)ethyl]pyrrole-2-carboxamide |
| SMILES | O=C(NCCC1=CCNCC1)c1cccn1CC(F)F |
| InChI | InChI=1S/C14H19F2N3O/c15-13(16)10-19-9-1-2-12(19)14(20)18-8-5-11-3-6-17-7-4-11/h1-3,9,13,17H,4-8,10H2,(H,18,20) |
| InChIKey | RHMROHQSHWUWRO-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 46.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.32 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|