C22H21N4O+ — CID 10498616
(2S,4S,5R)-4-methyl-5-phenyl-2-[4-(2H-[1,2,4]triazolo[1,5-a]pyridin-4-ium-2-yl)phenyl]-1,3-oxazolidine (PubChem CID 10498616) has the molecular formula C22H21N4O+ and a molecular weight of 357.44 g/mol. Its IUPAC name is (2S,4S,5R)-4-methyl-5-phenyl-2-[4-(2H-[1,2,4]triazolo[1,5-a]pyridin-4-ium-2-yl)phenyl]-1,3-oxazolidine.
| Compound Name | (2S,4S,5R)-4-methyl-5-phenyl-2-[4-(2H-[1,2,4]triazolo[1,5-a]pyridin-4-ium-2-yl)phenyl]-1,3-oxazolidine |
|---|---|
| PubChem CID | 10498616 |
| Molecular Formula | C22H21N4O+ |
| Molecular Weight | 357.44 g/mol |
| Exact Mass | 357.17 |
| IUPAC Name | (2S,4S,5R)-4-methyl-5-phenyl-2-[4-(2H-[1,2,4]triazolo[1,5-a]pyridin-4-ium-2-yl)phenyl]-1,3-oxazolidine |
| SMILES | C[C@@H]1N[C@H](c2ccc(C3N=c4cccc[n+]4=N3)cc2)O[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C22H21N4O/c1-15-20(16-7-3-2-4-8-16)27-22(23-15)18-12-10-17(11-13-18)21-24-19-9-5-6-14-26(19)25-21/h2-15,20-23H,1H3/q+1/t15-,20-,21?,22-/m0/s1 |
| InChIKey | CCKHMMLJSQXYBQ-WJNOUSRZSA-N |
| XLogP | 3.09 |
| TPSA | 51.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.44 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|