C11H15NO — CID 130754154
(2S,4S,5R)-2,4-dimethyl-5-phenyl-1,3-oxazolidine (PubChem CID 130754154) has the molecular formula C11H15NO and a molecular weight of 177.25 g/mol. Its IUPAC name is (2S,4S,5R)-2,4-dimethyl-5-phenyl-1,3-oxazolidine.
| Compound Name | (2S,4S,5R)-2,4-dimethyl-5-phenyl-1,3-oxazolidine |
|---|---|
| PubChem CID | 130754154 |
| Molecular Formula | C11H15NO |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.12 |
| IUPAC Name | (2S,4S,5R)-2,4-dimethyl-5-phenyl-1,3-oxazolidine |
| SMILES | C[C@@H]1N[C@H](C)O[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C11H15NO/c1-8-11(13-9(2)12-8)10-6-4-3-5-7-10/h3-9,11-12H,1-2H3/t8-,9-,11-/m0/s1 |
| InChIKey | KWVWCOPFNFBTBN-QXEWZRGKSA-N |
| XLogP | 2.08 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |