C18H19NO7 — CID 10498790
2-O-benzyl 3-O,4-O-dimethyl (2R,3R,4S,5S)-7-oxo-1-azabicyclo[3.2.0]heptane-2,3,4-tricarboxylate (PubChem CID 10498790) has the molecular formula C18H19NO7 and a molecular weight of 361.35 g/mol. Its IUPAC name is 2-O-benzyl 3-O,4-O-dimethyl (2R,3R,4S,5S)-7-oxo-1-azabicyclo[3.2.0]heptane-2,3,4-tricarboxylate.
| Compound Name | 2-O-benzyl 3-O,4-O-dimethyl (2R,3R,4S,5S)-7-oxo-1-azabicyclo[3.2.0]heptane-2,3,4-tricarboxylate |
|---|---|
| PubChem CID | 10498790 |
| Molecular Formula | C18H19NO7 |
| Molecular Weight | 361.35 g/mol |
| Exact Mass | 361.12 |
| IUPAC Name | 2-O-benzyl 3-O,4-O-dimethyl (2R,3R,4S,5S)-7-oxo-1-azabicyclo[3.2.0]heptane-2,3,4-tricarboxylate |
| SMILES | COC(=O)[C@@H]1[C@H](C(=O)OC)[C@@H]2CC(=O)N2[C@H]1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C18H19NO7/c1-24-16(21)13-11-8-12(20)19(11)15(14(13)17(22)25-2)18(23)26-9-10-6-4-3-5-7-10/h3-7,11,13-15H,8-9H2,1-2H3/t11-,13+,14+,15+/m0/s1 |
| InChIKey | SMZJUDJZMABVBN-ZGKBOVNRSA-N |
| XLogP | 0.29 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.35 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|