C24H33NO7Si — CID 71518132
1-O-benzyl 2-O-methyl (2S,3aR,8R,8aS)-8-[tert-butyl(dimethyl)silyl]oxy-4-oxo-3,3a,8,8a-tetrahydro-2H-oxepino[4,3-b]pyrrole-1,2-dicarboxylate (PubChem CID 71518132) has the molecular formula C24H33NO7Si and a molecular weight of 475.61 g/mol. Its IUPAC name is 1-O-benzyl 2-O-methyl (2S,3aR,8R,8aS)-8-[tert-butyl(dimethyl)silyl]oxy-4-oxo-3,3a,8,8a-tetrahydro-2H-oxepino[4,3-b]pyrrole-1,2-dicarboxylate.
| Compound Name | 1-O-benzyl 2-O-methyl (2S,3aR,8R,8aS)-8-[tert-butyl(dimethyl)silyl]oxy-4-oxo-3,3a,8,8a-tetrahydro-2H-oxepino[4,3-b]pyrrole-1,2-dicarboxylate |
|---|---|
| PubChem CID | 71518132 |
| Molecular Formula | C24H33NO7Si |
| Molecular Weight | 475.61 g/mol |
| Exact Mass | 475.20 |
| IUPAC Name | 1-O-benzyl 2-O-methyl (2S,3aR,8R,8aS)-8-[tert-butyl(dimethyl)silyl]oxy-4-oxo-3,3a,8,8a-tetrahydro-2H-oxepino[4,3-b]pyrrole-1,2-dicarboxylate |
| SMILES | COC(=O)[C@@H]1C[C@H]2C(=O)OC=C[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]2N1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C24H33NO7Si/c1-24(2,3)33(5,6)32-19-12-13-30-21(26)17-14-18(22(27)29-4)25(20(17)19)23(28)31-15-16-10-8-7-9-11-16/h7-13,17-20H,14-15H2,1-6H3/t17-,18+,19-,20+/m1/s1 |
| InChIKey | XXPKSEUWTJIXCL-WCIQWLHISA-N |
| XLogP | 4.02 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.61 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|