C16H21NS — CID 104990648
(5-ethylthiophen-2-yl)-(2,4,5-trimethylphenyl)methanamine (PubChem CID 104990648) has the molecular formula C16H21NS and a molecular weight of 259.42 g/mol. Its IUPAC name is (5-ethylthiophen-2-yl)-(2,4,5-trimethylphenyl)methanamine.
| Compound Name | (5-ethylthiophen-2-yl)-(2,4,5-trimethylphenyl)methanamine |
|---|---|
| PubChem CID | 104990648 |
| Molecular Formula | C16H21NS |
| Molecular Weight | 259.42 g/mol |
| Exact Mass | 259.14 |
| IUPAC Name | (5-ethylthiophen-2-yl)-(2,4,5-trimethylphenyl)methanamine |
| SMILES | CCc1ccc(C(N)c2cc(C)c(C)cc2C)s1 |
| InChI | InChI=1S/C16H21NS/c1-5-13-6-7-15(18-13)16(17)14-9-11(3)10(2)8-12(14)4/h6-9,16H,5,17H2,1-4H3 |
| InChIKey | LTLQOEDWSBRNLP-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.42 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |