C15H17BrOS — CID 90394992
(5-bromo-2,4-dimethylphenyl)-(5-ethylthiophen-2-yl)methanol (PubChem CID 90394992) has the molecular formula C15H17BrOS and a molecular weight of 325.27 g/mol. Its IUPAC name is (5-bromo-2,4-dimethylphenyl)-(5-ethylthiophen-2-yl)methanol.
| Compound Name | (5-bromo-2,4-dimethylphenyl)-(5-ethylthiophen-2-yl)methanol |
|---|---|
| PubChem CID | 90394992 |
| Molecular Formula | C15H17BrOS |
| Molecular Weight | 325.27 g/mol |
| Exact Mass | 324.02 |
| IUPAC Name | (5-bromo-2,4-dimethylphenyl)-(5-ethylthiophen-2-yl)methanol |
| SMILES | CCc1ccc(C(O)c2cc(Br)c(C)cc2C)s1 |
| InChI | InChI=1S/C15H17BrOS/c1-4-11-5-6-14(18-11)15(17)12-8-13(16)10(3)7-9(12)2/h5-8,15,17H,4H2,1-3H3 |
| InChIKey | SYYUFQHERHOFLB-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.27 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |